C16H24BrN5O3 — CID 162380966
tert-butyl (3S)-3-[3-bromo-4-cyano-5-(2-methoxyethylamino)pyrazol-1-yl]pyrrolidine-1-carboxylate (PubChem CID 162380966) has the molecular formula C16H24BrN5O3 and a molecular weight of 414.30 g/mol. Its IUPAC name is tert-butyl (3S)-3-[3-bromo-4-cyano-5-(2-methoxyethylamino)pyrazol-1-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[3-bromo-4-cyano-5-(2-methoxyethylamino)pyrazol-1-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 162380966 |
| Molecular Formula | C16H24BrN5O3 |
| Molecular Weight | 414.30 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | tert-butyl (3S)-3-[3-bromo-4-cyano-5-(2-methoxyethylamino)pyrazol-1-yl]pyrrolidine-1-carboxylate |
| SMILES | COCCNc1c(C#N)c(Br)nn1[C@H]1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H24BrN5O3/c1-16(2,3)25-15(23)21-7-5-11(10-21)22-14(19-6-8-24-4)12(9-18)13(17)20-22/h11,19H,5-8,10H2,1-4H3/t11-/m0/s1 |
| InChIKey | SKNKHXBZCQOLMR-NSHDSACASA-N |
| XLogP | 2.76 |
| TPSA | 92.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|