About 5-[2-(3,6-dimethylquinolin-7-yl)ethynyl]-3-(methylamino)-1H-pyrazole-4-carboxamide
5-[2-(3,6-dimethylquinolin-7-yl)ethynyl]-3-(methylamino)-1H-pyrazole-4-carboxamide (PubChem CID 162381141) has the molecular formula C18H17N5O
and a molecular weight of 319.37 g/mol. Its IUPAC name is 5-[2-(3,6-dimethylquinolin-7-yl)ethynyl]-3-(methylamino)-1H-pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-[2-(3,6-dimethylquinolin-7-yl)ethynyl]-3-(methylamino)-1H-pyrazole-4-carboxamide |
| PubChem CID | 162381141 |
| Molecular Formula | C18H17N5O |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 5-[2-(3,6-dimethylquinolin-7-yl)ethynyl]-3-(methylamino)-1H-pyrazole-4-carboxamide |
| SMILES | CNc1n[nH]c(C#Cc2cc3ncc(C)cc3cc2C)c1C(N)=O |
| InChI | InChI=1S/C18H17N5O/c1-10-6-13-7-11(2)12(8-15(13)21-9-10)4-5-14-16(17(19)24)18(20-3)23-22-14/h6-9H,1-3H3,(H2,19,24)(H2,20,22,23) |
| InChIKey | FNCFLIYVVHHPMP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-(3,6-dimethylquinolin-7-yl)ethynyl]-3-(methylamino)-1H-pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(3,6-dimethylquinolin-7-yl)ethynyl]-3-(methylamino)-1H-pyrazole-4-carboxamide?
The IUPAC name of 5-[2-(3,6-dimethylquinolin-7-yl)ethynyl]-3-(methylamino)-1H-pyrazole-4-carboxamide (CID 162381141) is 5-[2-(3,6-dimethylquinolin-7-yl)ethynyl]-3-(methylamino)-1H-pyrazole-4-carboxamide.
What is the SMILES notation for 5-[2-(3,6-dimethylquinolin-7-yl)ethynyl]-3-(methylamino)-1H-pyrazole-4-carboxamide?
The canonical SMILES for 5-[2-(3,6-dimethylquinolin-7-yl)ethynyl]-3-(methylamino)-1H-pyrazole-4-carboxamide is CNc1n[nH]c(C#Cc2cc3ncc(C)cc3cc2C)c1C(N)=O.
What is the InChIKey of 5-[2-(3,6-dimethylquinolin-7-yl)ethynyl]-3-(methylamino)-1H-pyrazole-4-carboxamide?
The InChIKey is FNCFLIYVVHHPMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N5O/c1-10-6-13-7-11(2)12(8-15(13)21-9-10)4-5-14-16(17(19)24)18(20-3)23-22-14/h6-9H,1-3H3,(H2,19,24)(H2,20,22,23).
What are the key properties of 5-[2-(3,6-dimethylquinolin-7-yl)ethynyl]-3-(methylamino)-1H-pyrazole-4-carboxamide?
5-[2-(3,6-dimethylquinolin-7-yl)ethynyl]-3-(methylamino)-1H-pyrazole-4-carboxamide has a molecular weight of 319.37 g/mol, XLogP of 2.12, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(3,6-dimethylquinolin-7-yl)ethynyl]-3-(methylamino)-1H-pyrazole-4-carboxamide is sourced from PubChem (CID 162381141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).