C16H11F2N5O — CID 162381934
5-[2-(3,6-difluoroquinolin-7-yl)ethynyl]-3-(methylamino)-1H-pyrazole-4-carboxamide (PubChem CID 162381934) has the molecular formula C16H11F2N5O and a molecular weight of 327.29 g/mol. Its IUPAC name is 5-[2-(3,6-difluoroquinolin-7-yl)ethynyl]-3-(methylamino)-1H-pyrazole-4-carboxamide.
| Compound Name | 5-[2-(3,6-difluoroquinolin-7-yl)ethynyl]-3-(methylamino)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 162381934 |
| Molecular Formula | C16H11F2N5O |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 5-[2-(3,6-difluoroquinolin-7-yl)ethynyl]-3-(methylamino)-1H-pyrazole-4-carboxamide |
| SMILES | CNc1n[nH]c(C#Cc2cc3ncc(F)cc3cc2F)c1C(N)=O |
| InChI | InChI=1S/C16H11F2N5O/c1-20-16-14(15(19)24)12(22-23-16)3-2-8-6-13-9(5-11(8)18)4-10(17)7-21-13/h4-7H,1H3,(H2,19,24)(H2,20,22,23) |
| InChIKey | MSDOHLFUJHHQHV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|