C15H12F2N2O4 — CID 172703252
3-[(6,7-difluoroquinolin-3-yl)amino]-2-ethoxycarbonylprop-2-enoic acid (PubChem CID 172703252) has the molecular formula C15H12F2N2O4 and a molecular weight of 322.27 g/mol. Its IUPAC name is 3-[(6,7-difluoroquinolin-3-yl)amino]-2-ethoxycarbonylprop-2-enoic acid.
| Compound Name | 3-[(6,7-difluoroquinolin-3-yl)amino]-2-ethoxycarbonylprop-2-enoic acid |
|---|---|
| PubChem CID | 172703252 |
| Molecular Formula | C15H12F2N2O4 |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 3-[(6,7-difluoroquinolin-3-yl)amino]-2-ethoxycarbonylprop-2-enoic acid |
| SMILES | CCOC(=O)C(=CNc1cnc2cc(F)c(F)cc2c1)C(=O)O |
| InChI | InChI=1S/C15H12F2N2O4/c1-2-23-15(22)10(14(20)21)7-18-9-3-8-4-11(16)12(17)5-13(8)19-6-9/h3-7,18H,2H2,1H3,(H,20,21) |
| InChIKey | DFZOFPXIPFQHMA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|