C12H19ClN2 — CID 162381464
N'-(4-chloro-3-methylphenyl)-N,N-dimethylmethanimidamide;ethane (PubChem CID 162381464) has the molecular formula C12H19ClN2 and a molecular weight of 226.75 g/mol. Its IUPAC name is N'-(4-chloro-3-methylphenyl)-N,N-dimethylmethanimidamide;ethane.
| Compound Name | N'-(4-chloro-3-methylphenyl)-N,N-dimethylmethanimidamide;ethane |
|---|---|
| PubChem CID | 162381464 |
| Molecular Formula | C12H19ClN2 |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | N'-(4-chloro-3-methylphenyl)-N,N-dimethylmethanimidamide;ethane |
| SMILES | CC.Cc1cc(/N=C/N(C)C)ccc1Cl |
| InChI | InChI=1S/C10H13ClN2.C2H6/c1-8-6-9(4-5-10(8)11)12-7-13(2)3;1-2/h4-7H,1-3H3;1-2H3/b12-7+; |
| InChIKey | YSRXULKEVLQSSB-RRAJOLSVSA-N |
| XLogP | 3.90 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|