C9H10ClFN2 — CID 131233035
N'-(4-chloro-2-fluorophenyl)-N,N-dimethylmethanimidamide (PubChem CID 131233035) has the molecular formula C9H10ClFN2 and a molecular weight of 200.64 g/mol. Its IUPAC name is N'-(4-chloro-2-fluorophenyl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(4-chloro-2-fluorophenyl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 131233035 |
| Molecular Formula | C9H10ClFN2 |
| Molecular Weight | 200.64 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | N'-(4-chloro-2-fluorophenyl)-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1ccc(Cl)cc1F |
| InChI | InChI=1S/C9H10ClFN2/c1-13(2)6-12-9-4-3-7(10)5-8(9)11/h3-6H,1-2H3/b12-6+ |
| InChIKey | XPARCUWQGONJKL-WUXMJOGZSA-N |
| XLogP | 2.70 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.64 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|