C11H13N3 — CID 11446788
N'-(2-cyano-4-methylphenyl)-N,N-dimethylmethanimidamide (PubChem CID 11446788) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is N'-(2-cyano-4-methylphenyl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(2-cyano-4-methylphenyl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 11446788 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | N'-(2-cyano-4-methylphenyl)-N,N-dimethylmethanimidamide |
| SMILES | Cc1ccc(/N=C/N(C)C)c(C#N)c1 |
| InChI | InChI=1S/C11H13N3/c1-9-4-5-11(10(6-9)7-12)13-8-14(2)3/h4-6,8H,1-3H3/b13-8+ |
| InChIKey | IRWQEKUGQPZJRO-MDWZMJQESA-N |
| XLogP | 2.09 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|