C23H30FN5O — CID 67174860
N'-[2-cyano-4-[4-[2-[2-(dimethylamino)ethyl-methylamino]ethoxy]-3-fluorophenyl]phenyl]-N,N-dimethylmethanimidamide (PubChem CID 67174860) has the molecular formula C23H30FN5O and a molecular weight of 411.53 g/mol. Its IUPAC name is N'-[2-cyano-4-[4-[2-[2-(dimethylamino)ethyl-methylamino]ethoxy]-3-fluorophenyl]phenyl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[2-cyano-4-[4-[2-[2-(dimethylamino)ethyl-methylamino]ethoxy]-3-fluorophenyl]phenyl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 67174860 |
| Molecular Formula | C23H30FN5O |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | N'-[2-cyano-4-[4-[2-[2-(dimethylamino)ethyl-methylamino]ethoxy]-3-fluorophenyl]phenyl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1ccc(-c2ccc(OCCN(C)CCN(C)C)c(F)c2)cc1C#N |
| InChI | InChI=1S/C23H30FN5O/c1-27(2)10-11-29(5)12-13-30-23-9-7-19(15-21(23)24)18-6-8-22(20(14-18)16-25)26-17-28(3)4/h6-9,14-15,17H,10-13H2,1-5H3/b26-17+ |
| InChIKey | GFAHQJSVAGIJAP-YZSQISJMSA-N |
| XLogP | 3.46 |
| TPSA | 55.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|