C10H9FN4O2 — CID 118900243
N'-(2-cyano-5-fluoro-4-nitrophenyl)-N,N-dimethylmethanimidamide (PubChem CID 118900243) has the molecular formula C10H9FN4O2 and a molecular weight of 236.21 g/mol. Its IUPAC name is N'-(2-cyano-5-fluoro-4-nitrophenyl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(2-cyano-5-fluoro-4-nitrophenyl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 118900243 |
| Molecular Formula | C10H9FN4O2 |
| Molecular Weight | 236.21 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | N'-(2-cyano-5-fluoro-4-nitrophenyl)-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1cc(F)c([N+](=O)[O-])cc1C#N |
| InChI | InChI=1S/C10H9FN4O2/c1-14(2)6-13-9-4-8(11)10(15(16)17)3-7(9)5-12/h3-4,6H,1-2H3/b13-6+ |
| InChIKey | UVGATYIHNOCTPO-AWNIVKPZSA-N |
| XLogP | 1.83 |
| TPSA | 82.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.21 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|