C10H9N4O2Y- — CID 169028844
N'-(2-cyano-4-nitrobenzene-3-id-1-yl)-N,N-dimethylmethanimidamide;yttrium (PubChem CID 169028844) has the molecular formula C10H9N4O2Y- and a molecular weight of 306.11 g/mol. Its IUPAC name is N'-(2-cyano-4-nitrobenzene-3-id-1-yl)-N,N-dimethylmethanimidamide;yttrium.
| Compound Name | N'-(2-cyano-4-nitrobenzene-3-id-1-yl)-N,N-dimethylmethanimidamide;yttrium |
|---|---|
| PubChem CID | 169028844 |
| Molecular Formula | C10H9N4O2Y- |
| Molecular Weight | 306.11 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | N'-(2-cyano-4-nitrobenzene-3-id-1-yl)-N,N-dimethylmethanimidamide;yttrium |
| SMILES | CN(C)/C=N/c1ccc([N+](=O)[O-])[c-]c1C#N.[Y] |
| InChI | InChI=1S/C10H9N4O2.Y/c1-13(2)7-12-10-4-3-9(14(15)16)5-8(10)6-11;/h3-4,7H,1-2H3;/q-1;/b12-7+; |
| InChIKey | AFHGJIHNOGFGKC-RRAJOLSVSA-N |
| XLogP | 1.49 |
| TPSA | 82.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.11 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|