C7H4N2O4 — CID 112719946
2,4-dihydroxy-5-nitrobenzonitrile (PubChem CID 112719946) has the molecular formula C7H4N2O4 and a molecular weight of 180.12 g/mol. Its IUPAC name is 2,4-dihydroxy-5-nitrobenzonitrile.
| Compound Name | 2,4-dihydroxy-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 112719946 |
| Molecular Formula | C7H4N2O4 |
| Molecular Weight | 180.12 g/mol |
| Exact Mass | 180.02 |
| IUPAC Name | 2,4-dihydroxy-5-nitrobenzonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])c(O)cc1O |
| InChI | InChI=1S/C7H4N2O4/c8-3-4-1-5(9(12)13)7(11)2-6(4)10/h1-2,10-11H |
| InChIKey | ZSXBAFMRSKHTNG-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 107.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.12 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|