C14H7N3O4 — CID 152645874
4-(3-hydroxy-4-nitrophenoxy)benzene-1,2-dicarbonitrile (PubChem CID 152645874) has the molecular formula C14H7N3O4 and a molecular weight of 281.23 g/mol. Its IUPAC name is 4-(3-hydroxy-4-nitrophenoxy)benzene-1,2-dicarbonitrile.
| Compound Name | 4-(3-hydroxy-4-nitrophenoxy)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 152645874 |
| Molecular Formula | C14H7N3O4 |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 4-(3-hydroxy-4-nitrophenoxy)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(Oc2ccc([N+](=O)[O-])c(O)c2)cc1C#N |
| InChI | InChI=1S/C14H7N3O4/c15-7-9-1-2-11(5-10(9)8-16)21-12-3-4-13(17(19)20)14(18)6-12/h1-6,18H |
| InChIKey | ZGNIOKRDXLTAFO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 120.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|