C12H15N3O — CID 90139484
N'-(2-cyano-3-methoxy-5-methylphenyl)-N,N-dimethylmethanimidamide (PubChem CID 90139484) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is N'-(2-cyano-3-methoxy-5-methylphenyl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(2-cyano-3-methoxy-5-methylphenyl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 90139484 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | N'-(2-cyano-3-methoxy-5-methylphenyl)-N,N-dimethylmethanimidamide |
| SMILES | COc1cc(C)cc(/N=C/N(C)C)c1C#N |
| InChI | InChI=1S/C12H15N3O/c1-9-5-11(14-8-15(2)3)10(7-13)12(6-9)16-4/h5-6,8H,1-4H3/b14-8+ |
| InChIKey | CYBQBQVIMWYDLF-RIYZIHGNSA-N |
| XLogP | 2.10 |
| TPSA | 48.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|