C10H12N4 — CID 143498002
N'-(3-cyano-6-methyl-2-pyridinyl)-N,N-dimethylmethanimidamide (PubChem CID 143498002) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is N'-(3-cyano-6-methyl-2-pyridinyl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(3-cyano-6-methyl-2-pyridinyl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 143498002 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | N'-(3-cyano-6-methyl-2-pyridinyl)-N,N-dimethylmethanimidamide |
| SMILES | Cc1ccc(C#N)c(/N=C/N(C)C)n1 |
| InChI | InChI=1S/C10H12N4/c1-8-4-5-9(6-11)10(13-8)12-7-14(2)3/h4-5,7H,1-3H3/b12-7+ |
| InChIKey | SAJYPBMEMJSAJN-KPKJPENVSA-N |
| XLogP | 1.48 |
| TPSA | 52.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|