C22H19F2N7O2 — CID 162381477
5-amino-3-[2-(1-cyclopropyl-4,6-difluorobenzimidazol-5-yl)ethynyl]-1-(1-prop-2-enoylazetidin-3-yl)pyrazole-4-carboxamide (PubChem CID 162381477) has the molecular formula C22H19F2N7O2 and a molecular weight of 451.44 g/mol. Its IUPAC name is 5-amino-3-[2-(1-cyclopropyl-4,6-difluorobenzimidazol-5-yl)ethynyl]-1-(1-prop-2-enoylazetidin-3-yl)pyrazole-4-carboxamide.
| Compound Name | 5-amino-3-[2-(1-cyclopropyl-4,6-difluorobenzimidazol-5-yl)ethynyl]-1-(1-prop-2-enoylazetidin-3-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 162381477 |
| Molecular Formula | C22H19F2N7O2 |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 5-amino-3-[2-(1-cyclopropyl-4,6-difluorobenzimidazol-5-yl)ethynyl]-1-(1-prop-2-enoylazetidin-3-yl)pyrazole-4-carboxamide |
| SMILES | C=CC(=O)N1CC(n2nc(C#Cc3c(F)cc4c(ncn4C4CC4)c3F)c(C(N)=O)c2N)C1 |
| InChI | InChI=1S/C22H19F2N7O2/c1-2-17(32)29-8-12(9-29)31-21(25)18(22(26)33)15(28-31)6-5-13-14(23)7-16-20(19(13)24)27-10-30(16)11-3-4-11/h2,7,10-12H,1,3-4,8-9,25H2,(H2,26,33) |
| InChIKey | CIQJIMZSKPTOGS-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 125.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|