C27H30FN7O2 — CID 162381858
N-tert-butyl-3-[2-(1-cyclopropyl-6-fluorobenzimidazol-5-yl)ethynyl]-5-(methylamino)-1-(1-prop-2-enoylazetidin-3-yl)pyrazole-4-carboxamide (PubChem CID 162381858) has the molecular formula C27H30FN7O2 and a molecular weight of 503.58 g/mol. Its IUPAC name is N-tert-butyl-3-[2-(1-cyclopropyl-6-fluorobenzimidazol-5-yl)ethynyl]-5-(methylamino)-1-(1-prop-2-enoylazetidin-3-yl)pyrazole-4-carboxamide.
| Compound Name | N-tert-butyl-3-[2-(1-cyclopropyl-6-fluorobenzimidazol-5-yl)ethynyl]-5-(methylamino)-1-(1-prop-2-enoylazetidin-3-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 162381858 |
| Molecular Formula | C27H30FN7O2 |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | N-tert-butyl-3-[2-(1-cyclopropyl-6-fluorobenzimidazol-5-yl)ethynyl]-5-(methylamino)-1-(1-prop-2-enoylazetidin-3-yl)pyrazole-4-carboxamide |
| SMILES | C=CC(=O)N1CC(n2nc(C#Cc3cc4ncn(C5CC5)c4cc3F)c(C(=O)NC(C)(C)C)c2NC)C1 |
| InChI | InChI=1S/C27H30FN7O2/c1-6-23(36)33-13-18(14-33)35-25(29-5)24(26(37)31-27(2,3)4)20(32-35)10-7-16-11-21-22(12-19(16)28)34(15-30-21)17-8-9-17/h6,11-12,15,17-18,29H,1,8-9,13-14H2,2-5H3,(H,31,37) |
| InChIKey | XOVKSVWIKOEARB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|