C11H18N4O — CID 162381539
3-ethynyl-1-methyl-5-(methylamino)pyrazole-4-carboxamide;propane (PubChem CID 162381539) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is 3-ethynyl-1-methyl-5-(methylamino)pyrazole-4-carboxamide;propane.
| Compound Name | 3-ethynyl-1-methyl-5-(methylamino)pyrazole-4-carboxamide;propane |
|---|---|
| PubChem CID | 162381539 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 3-ethynyl-1-methyl-5-(methylamino)pyrazole-4-carboxamide;propane |
| SMILES | C#Cc1nn(C)c(NC)c1C(N)=O.CCC |
| InChI | InChI=1S/C8H10N4O.C3H8/c1-4-5-6(7(9)13)8(10-2)12(3)11-5;1-3-2/h1,10H,2-3H3,(H2,9,13);3H2,1-2H3 |
| InChIKey | ZYRSROYTHWLDLX-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|