C12H15F2N5O — CID 164780170
1-[(3S,5R)-5-(difluoromethyl)pyrrolidin-3-yl]-3-ethynyl-5-(methylamino)pyrazole-4-carboxamide (PubChem CID 164780170) has the molecular formula C12H15F2N5O and a molecular weight of 283.28 g/mol. Its IUPAC name is 1-[(3S,5R)-5-(difluoromethyl)pyrrolidin-3-yl]-3-ethynyl-5-(methylamino)pyrazole-4-carboxamide.
| Compound Name | 1-[(3S,5R)-5-(difluoromethyl)pyrrolidin-3-yl]-3-ethynyl-5-(methylamino)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 164780170 |
| Molecular Formula | C12H15F2N5O |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 1-[(3S,5R)-5-(difluoromethyl)pyrrolidin-3-yl]-3-ethynyl-5-(methylamino)pyrazole-4-carboxamide |
| SMILES | C#Cc1nn([C@@H]2CN[C@@H](C(F)F)C2)c(NC)c1C(N)=O |
| InChI | InChI=1S/C12H15F2N5O/c1-3-7-9(11(15)20)12(16-2)19(18-7)6-4-8(10(13)14)17-5-6/h1,6,8,10,16-17H,4-5H2,2H3,(H2,15,20)/t6-,8+/m0/s1 |
| InChIKey | VAECEWKVAZFLBN-POYBYMJQSA-N |
| XLogP | 0.17 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|