C15H17F2N5O2 — CID 162381047
1-[(3S,5R)-5-(difluoromethyl)-1-prop-2-enoylpyrrolidin-3-yl]-3-ethynyl-5-(methylamino)pyrazole-4-carboxamide (PubChem CID 162381047) has the molecular formula C15H17F2N5O2 and a molecular weight of 337.33 g/mol. Its IUPAC name is 1-[(3S,5R)-5-(difluoromethyl)-1-prop-2-enoylpyrrolidin-3-yl]-3-ethynyl-5-(methylamino)pyrazole-4-carboxamide.
| Compound Name | 1-[(3S,5R)-5-(difluoromethyl)-1-prop-2-enoylpyrrolidin-3-yl]-3-ethynyl-5-(methylamino)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 162381047 |
| Molecular Formula | C15H17F2N5O2 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 1-[(3S,5R)-5-(difluoromethyl)-1-prop-2-enoylpyrrolidin-3-yl]-3-ethynyl-5-(methylamino)pyrazole-4-carboxamide |
| SMILES | C#Cc1nn([C@H]2C[C@H](C(F)F)N(C(=O)C=C)C2)c(NC)c1C(N)=O |
| InChI | InChI=1S/C15H17F2N5O2/c1-4-9-12(14(18)24)15(19-3)22(20-9)8-6-10(13(16)17)21(7-8)11(23)5-2/h1,5,8,10,13,19H,2,6-7H2,3H3,(H2,18,24)/t8-,10+/m0/s1 |
| InChIKey | COUXASSSJHECCP-WCBMZHEXSA-N |
| XLogP | 0.60 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|