C17H21F2N5O3 — CID 162380897
1-[(3S,5R)-5-(1,1-difluoroethoxymethyl)-1-prop-2-enoylpyrrolidin-3-yl]-3-ethynyl-5-(methylamino)pyrazole-4-carboxamide (PubChem CID 162380897) has the molecular formula C17H21F2N5O3 and a molecular weight of 381.38 g/mol. Its IUPAC name is 1-[(3S,5R)-5-(1,1-difluoroethoxymethyl)-1-prop-2-enoylpyrrolidin-3-yl]-3-ethynyl-5-(methylamino)pyrazole-4-carboxamide.
| Compound Name | 1-[(3S,5R)-5-(1,1-difluoroethoxymethyl)-1-prop-2-enoylpyrrolidin-3-yl]-3-ethynyl-5-(methylamino)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 162380897 |
| Molecular Formula | C17H21F2N5O3 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 1-[(3S,5R)-5-(1,1-difluoroethoxymethyl)-1-prop-2-enoylpyrrolidin-3-yl]-3-ethynyl-5-(methylamino)pyrazole-4-carboxamide |
| SMILES | C#Cc1nn([C@H]2C[C@H](COC(C)(F)F)N(C(=O)C=C)C2)c(NC)c1C(N)=O |
| InChI | InChI=1S/C17H21F2N5O3/c1-5-12-14(15(20)26)16(21-4)24(22-12)10-7-11(9-27-17(3,18)19)23(8-10)13(25)6-2/h1,6,10-11,21H,2,7-9H2,3-4H3,(H2,20,26)/t10-,11+/m0/s1 |
| InChIKey | ONOSXBFYWDBVII-WDEREUQCSA-N |
| XLogP | 0.96 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|