C16H21N5O3Si — CID 162380746
CID 162380746 (PubChem CID 162380746) has the molecular formula C16H21N5O3Si and a molecular weight of 359.46 g/mol.
| Compound Name | CID 162380746 |
|---|---|
| PubChem CID | 162380746 |
| Molecular Formula | C16H21N5O3Si |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | — |
| SMILES | C#Cc1nn([C@H]2C[C@H](COC)N(C(=O)C=C)C[Si]2)c(NC)c1C(N)=O |
| InChI | InChI=1S/C16H21N5O3Si/c1-5-11-14(15(17)23)16(18-3)21(19-11)13-7-10(8-24-4)20(9-25-13)12(22)6-2/h1,6,10,13,18H,2,7-9H2,3-4H3,(H2,17,23)/t10-,13-/m1/s1 |
| InChIKey | TVLIZJJTZIGOFI-ZWNOBZJWSA-N |
| XLogP | -0.40 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|