C16H19F2N5O3 — CID 162381702
1-[(3S,5R)-5-(difluoromethoxymethyl)-1-prop-2-enoylpyrrolidin-3-yl]-3-ethynyl-5-(methylamino)pyrazole-4-carboxamide (PubChem CID 162381702) has the molecular formula C16H19F2N5O3 and a molecular weight of 367.36 g/mol. Its IUPAC name is 1-[(3S,5R)-5-(difluoromethoxymethyl)-1-prop-2-enoylpyrrolidin-3-yl]-3-ethynyl-5-(methylamino)pyrazole-4-carboxamide.
| Compound Name | 1-[(3S,5R)-5-(difluoromethoxymethyl)-1-prop-2-enoylpyrrolidin-3-yl]-3-ethynyl-5-(methylamino)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 162381702 |
| Molecular Formula | C16H19F2N5O3 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 1-[(3S,5R)-5-(difluoromethoxymethyl)-1-prop-2-enoylpyrrolidin-3-yl]-3-ethynyl-5-(methylamino)pyrazole-4-carboxamide |
| SMILES | C#Cc1nn([C@H]2C[C@H](COC(F)F)N(C(=O)C=C)C2)c(NC)c1C(N)=O |
| InChI | InChI=1S/C16H19F2N5O3/c1-4-11-13(14(19)25)15(20-3)23(21-11)9-6-10(8-26-16(17)18)22(7-9)12(24)5-2/h1,5,9-10,16,20H,2,6-8H2,3H3,(H2,19,25)/t9-,10+/m0/s1 |
| InChIKey | VNZMMSFHPZMFFV-VHSXEESVSA-N |
| XLogP | 0.57 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|