C17H24N5O3Si — CID 162381546
CID 162381546 (PubChem CID 162381546) has the molecular formula C17H24N5O3Si and a molecular weight of 374.50 g/mol.
| Compound Name | CID 162381546 |
|---|---|
| PubChem CID | 162381546 |
| Molecular Formula | C17H24N5O3Si |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | — |
| SMILES | C#Cc1nn(CC[C@H](COC)N(CC[Si])C(=O)C=C)c(NC)c1C(N)=O |
| InChI | InChI=1S/C17H24N5O3Si/c1-5-13-15(16(18)24)17(19-3)22(20-13)8-7-12(11-25-4)21(9-10-26)14(23)6-2/h1,6,12,19H,2,7-11H2,3-4H3,(H2,18,24)/t12-/m1/s1 |
| InChIKey | CZNCTQDEFPTZHF-GFCCVEGCSA-N |
| XLogP | 0.01 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|