C37H38ClF3N6O3 — CID 162385527
methyl 2-[[4-[[3-(4-chlorophenyl)-3-imino-2-phenylpropyl]amino]-2-[[4-(trifluoromethyl)phenyl]methylamino]pyrimidine-5-carbonyl]amino]-2-cyclohexylacetate (PubChem CID 162385527) has the molecular formula C37H38ClF3N6O3 and a molecular weight of 707.20 g/mol. Its IUPAC name is methyl 2-[[4-[[3-(4-chlorophenyl)-3-imino-2-phenylpropyl]amino]-2-[[4-(trifluoromethyl)phenyl]methylamino]pyrimidine-5-carbonyl]amino]-2-cyclohexylacetate.
| Compound Name | methyl 2-[[4-[[3-(4-chlorophenyl)-3-imino-2-phenylpropyl]amino]-2-[[4-(trifluoromethyl)phenyl]methylamino]pyrimidine-5-carbonyl]amino]-2-cyclohexylacetate |
|---|---|
| PubChem CID | 162385527 |
| Molecular Formula | C37H38ClF3N6O3 |
| Molecular Weight | 707.20 g/mol |
| Exact Mass | 706.26 |
| IUPAC Name | methyl 2-[[4-[[3-(4-chlorophenyl)-3-imino-2-phenylpropyl]amino]-2-[[4-(trifluoromethyl)phenyl]methylamino]pyrimidine-5-carbonyl]amino]-2-cyclohexylacetate |
| SMILES | [H]/N=C(\c1ccc(Cl)cc1)C(CNc1nc(NCc2ccc(C(F)(F)F)cc2)ncc1C(=O)NC(C(=O)OC)C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C37H38ClF3N6O3/c1-50-35(49)32(26-10-6-3-7-11-26)46-34(48)30-22-45-36(44-20-23-12-16-27(17-13-23)37(39,40)41)47-33(30)43-21-29(24-8-4-2-5-9-24)31(42)25-14-18-28(38)19-15-25/h2,4-5,8-9,12-19,22,26,29,32,42H,3,6-7,10-11,20-21H2,1H3,(H,46,48)(H2,43,44,45,47)/b42-31+ |
| InChIKey | CTGGXBLDKAHHBS-FEMONOMJSA-N |
| XLogP | 7.88 |
| TPSA | 129.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.20 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|