C12H12N4O6 — CID 162385963
1-[(E)-4-(2,5-dioxopiperazin-1-yl)-4-oxobut-2-enoyl]piperazine-2,5-dione (PubChem CID 162385963) has the molecular formula C12H12N4O6 and a molecular weight of 308.25 g/mol. Its IUPAC name is 1-[(E)-4-(2,5-dioxopiperazin-1-yl)-4-oxobut-2-enoyl]piperazine-2,5-dione.
| Compound Name | 1-[(E)-4-(2,5-dioxopiperazin-1-yl)-4-oxobut-2-enoyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 162385963 |
| Molecular Formula | C12H12N4O6 |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 1-[(E)-4-(2,5-dioxopiperazin-1-yl)-4-oxobut-2-enoyl]piperazine-2,5-dione |
| SMILES | O=C1CN(C(=O)/C=C/C(=O)N2CC(=O)NCC2=O)C(=O)CN1 |
| InChI | InChI=1S/C12H12N4O6/c17-7-5-15(11(21)3-13-7)9(19)1-2-10(20)16-6-8(18)14-4-12(16)22/h1-2H,3-6H2,(H,13,17)(H,14,18)/b2-1+ |
| InChIKey | SIFRDBKLEKSMIP-OWOJBTEDSA-N |
| XLogP | -3.49 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | -3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|