C19H26N2O5 — CID 162387255
hexyl N-[(3R)-2-carbamoyl-4-oxo-5-phenoxypent-1-en-3-yl]carbamate (PubChem CID 162387255) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is hexyl N-[(3R)-2-carbamoyl-4-oxo-5-phenoxypent-1-en-3-yl]carbamate.
| Compound Name | hexyl N-[(3R)-2-carbamoyl-4-oxo-5-phenoxypent-1-en-3-yl]carbamate |
|---|---|
| PubChem CID | 162387255 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | hexyl N-[(3R)-2-carbamoyl-4-oxo-5-phenoxypent-1-en-3-yl]carbamate |
| SMILES | C=C(C(N)=O)[C@@H](NC(=O)OCCCCCC)C(=O)COc1ccccc1 |
| InChI | InChI=1S/C19H26N2O5/c1-3-4-5-9-12-25-19(24)21-17(14(2)18(20)23)16(22)13-26-15-10-7-6-8-11-15/h6-8,10-11,17H,2-5,9,12-13H2,1H3,(H2,20,23)(H,21,24)/t17-/m1/s1 |
| InChIKey | ZTIGUABUQLFTOF-QGZVFWFLSA-N |
| XLogP | 2.35 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|