C21H29N3O5 — CID 166884746
hexyl N-[(3R)-2-carbamoyl-4,5-dioxo-5-(2-phenylethylamino)pent-1-en-3-yl]carbamate (PubChem CID 166884746) has the molecular formula C21H29N3O5 and a molecular weight of 403.48 g/mol. Its IUPAC name is hexyl N-[(3R)-2-carbamoyl-4,5-dioxo-5-(2-phenylethylamino)pent-1-en-3-yl]carbamate.
| Compound Name | hexyl N-[(3R)-2-carbamoyl-4,5-dioxo-5-(2-phenylethylamino)pent-1-en-3-yl]carbamate |
|---|---|
| PubChem CID | 166884746 |
| Molecular Formula | C21H29N3O5 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | hexyl N-[(3R)-2-carbamoyl-4,5-dioxo-5-(2-phenylethylamino)pent-1-en-3-yl]carbamate |
| SMILES | C=C(C(N)=O)[C@@H](NC(=O)OCCCCCC)C(=O)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C21H29N3O5/c1-3-4-5-9-14-29-21(28)24-17(15(2)19(22)26)18(25)20(27)23-13-12-16-10-7-6-8-11-16/h6-8,10-11,17H,2-5,9,12-14H2,1H3,(H2,22,26)(H,23,27)(H,24,28)/t17-/m1/s1 |
| InChIKey | YRVKMHYFWBXKEP-QGZVFWFLSA-N |
| XLogP | 1.63 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|