C14H17FN2 — CID 162389016
2-(5-fluoroindol-1-yl)-N,N-dimethylcyclobutan-1-amine (PubChem CID 162389016) has the molecular formula C14H17FN2 and a molecular weight of 232.30 g/mol. Its IUPAC name is 2-(5-fluoroindol-1-yl)-N,N-dimethylcyclobutan-1-amine.
| Compound Name | 2-(5-fluoroindol-1-yl)-N,N-dimethylcyclobutan-1-amine |
|---|---|
| PubChem CID | 162389016 |
| Molecular Formula | C14H17FN2 |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 2-(5-fluoroindol-1-yl)-N,N-dimethylcyclobutan-1-amine |
| SMILES | CN(C)C1CCC1n1ccc2cc(F)ccc21 |
| InChI | InChI=1S/C14H17FN2/c1-16(2)13-5-6-14(13)17-8-7-10-9-11(15)3-4-12(10)17/h3-4,7-9,13-14H,5-6H2,1-2H3 |
| InChIKey | ZBRMEJSXQPPNQQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |