C38H64N2O6Si2 — CID 162392866
tri(propan-2-yloxy)-[4-[7-[4-tri(propan-2-yloxy)silylbutyl]-1,10-phenanthrolin-4-yl]butyl]silane (PubChem CID 162392866) has the molecular formula C38H64N2O6Si2 and a molecular weight of 701.11 g/mol. Its IUPAC name is tri(propan-2-yloxy)-[4-[7-[4-tri(propan-2-yloxy)silylbutyl]-1,10-phenanthrolin-4-yl]butyl]silane.
| Compound Name | tri(propan-2-yloxy)-[4-[7-[4-tri(propan-2-yloxy)silylbutyl]-1,10-phenanthrolin-4-yl]butyl]silane |
|---|---|
| PubChem CID | 162392866 |
| Molecular Formula | C38H64N2O6Si2 |
| Molecular Weight | 701.11 g/mol |
| Exact Mass | 700.43 |
| IUPAC Name | tri(propan-2-yloxy)-[4-[7-[4-tri(propan-2-yloxy)silylbutyl]-1,10-phenanthrolin-4-yl]butyl]silane |
| SMILES | CC(C)O[Si](CCCCc1ccnc2c1ccc1c(CCCC[Si](OC(C)C)(OC(C)C)OC(C)C)ccnc12)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C38H64N2O6Si2/c1-27(2)41-47(42-28(3)4,43-29(5)6)25-15-13-17-33-21-23-39-37-35(33)19-20-36-34(22-24-40-38(36)37)18-14-16-26-48(44-30(7)8,45-31(9)10)46-32(11)12/h19-24,27-32H,13-18,25-26H2,1-12H3 |
| InChIKey | LPJHFQTXRIYPES-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 81.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.11 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|