C20H19F3O3 — CID 162393486
[(1S)-1-phenylbut-3-enyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 162393486) has the molecular formula C20H19F3O3 and a molecular weight of 364.36 g/mol. Its IUPAC name is [(1S)-1-phenylbut-3-enyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(1S)-1-phenylbut-3-enyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 162393486 |
| Molecular Formula | C20H19F3O3 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | [(1S)-1-phenylbut-3-enyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | C=CC[C@H](OC(=O)[C@@](OC)(c1ccccc1)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C20H19F3O3/c1-3-10-17(15-11-6-4-7-12-15)26-18(24)19(25-2,20(21,22)23)16-13-8-5-9-14-16/h3-9,11-14,17H,1,10H2,2H3/t17-,19-/m0/s1 |
| InChIKey | BOYYWSZWBVYVRR-HKUYNNGSSA-N |
| XLogP | 4.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|