C16H11NO6 — CID 162395967
(3E)-5,6-dihydroxy-3-[(3-nitrophenyl)methylidene]chromen-4-one (PubChem CID 162395967) has the molecular formula C16H11NO6 and a molecular weight of 313.26 g/mol. Its IUPAC name is (3E)-5,6-dihydroxy-3-[(3-nitrophenyl)methylidene]chromen-4-one.
| Compound Name | (3E)-5,6-dihydroxy-3-[(3-nitrophenyl)methylidene]chromen-4-one |
|---|---|
| PubChem CID | 162395967 |
| Molecular Formula | C16H11NO6 |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | (3E)-5,6-dihydroxy-3-[(3-nitrophenyl)methylidene]chromen-4-one |
| SMILES | O=C1/C(=C/c2cccc([N+](=O)[O-])c2)COc2ccc(O)c(O)c21 |
| InChI | InChI=1S/C16H11NO6/c18-12-4-5-13-14(16(12)20)15(19)10(8-23-13)6-9-2-1-3-11(7-9)17(21)22/h1-7,18,20H,8H2/b10-6+ |
| InChIKey | UONQPGHPRMZYCY-UXBLZVDNSA-N |
| XLogP | 2.66 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|