C11H22O2Si — CID 162397168
(2S,3S)-3-triethylsilylpent-4-yne-1,2-diol (PubChem CID 162397168) has the molecular formula C11H22O2Si and a molecular weight of 214.38 g/mol. Its IUPAC name is (2S,3S)-3-triethylsilylpent-4-yne-1,2-diol.
| Compound Name | (2S,3S)-3-triethylsilylpent-4-yne-1,2-diol |
|---|---|
| PubChem CID | 162397168 |
| Molecular Formula | C11H22O2Si |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | (2S,3S)-3-triethylsilylpent-4-yne-1,2-diol |
| SMILES | C#C[C@@H]([C@@H](O)CO)[Si](CC)(CC)CC |
| InChI | InChI=1S/C11H22O2Si/c1-5-11(10(13)9-12)14(6-2,7-3)8-4/h1,10-13H,6-9H2,2-4H3/t10-,11-/m0/s1 |
| InChIKey | XPBXPRUKHXTYTO-QWRGUYRKSA-N |
| XLogP | 1.85 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|