C22H40N2O8Si — CID 162397436
tert-butyl (6R,7S,7aS)-7-hydroxy-7-[(1S,3R)-4-[methoxy(methyl)amino]-3-methyl-4-oxo-1-trimethylsilyloxybutyl]-6-methyl-5-oxo-3,6-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-7a-carboxylate (PubChem CID 162397436) has the molecular formula C22H40N2O8Si and a molecular weight of 488.65 g/mol. Its IUPAC name is tert-butyl (6R,7S,7aS)-7-hydroxy-7-[(1S,3R)-4-[methoxy(methyl)amino]-3-methyl-4-oxo-1-trimethylsilyloxybutyl]-6-methyl-5-oxo-3,6-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-7a-carboxylate.
| Compound Name | tert-butyl (6R,7S,7aS)-7-hydroxy-7-[(1S,3R)-4-[methoxy(methyl)amino]-3-methyl-4-oxo-1-trimethylsilyloxybutyl]-6-methyl-5-oxo-3,6-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
|---|---|
| PubChem CID | 162397436 |
| Molecular Formula | C22H40N2O8Si |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | tert-butyl (6R,7S,7aS)-7-hydroxy-7-[(1S,3R)-4-[methoxy(methyl)amino]-3-methyl-4-oxo-1-trimethylsilyloxybutyl]-6-methyl-5-oxo-3,6-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
| SMILES | CON(C)C(=O)[C@H](C)C[C@H](O[Si](C)(C)C)[C@]1(O)[C@@H](C)C(=O)N2COC[C@]21C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H40N2O8Si/c1-14(17(25)23(6)29-7)11-16(32-33(8,9)10)22(28)15(2)18(26)24-13-30-12-21(22,24)19(27)31-20(3,4)5/h14-16,28H,11-13H2,1-10H3/t14-,15+,16+,21-,22-/m1/s1 |
| InChIKey | REWSIOIMIMDWDM-ZMOGBTBASA-N |
| XLogP | 1.53 |
| TPSA | 114.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|