C23H42NO10PSi — CID 162397437
tert-butyl (6R,7S,7aS)-7-[(1S,3R)-5-dimethoxyphosphoryl-3-methyl-4-oxo-1-trimethylsilyloxypentyl]-7-hydroxy-6-methyl-5-oxo-3,6-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-7a-carboxylate (PubChem CID 162397437) has the molecular formula C23H42NO10PSi and a molecular weight of 551.65 g/mol. Its IUPAC name is tert-butyl (6R,7S,7aS)-7-[(1S,3R)-5-dimethoxyphosphoryl-3-methyl-4-oxo-1-trimethylsilyloxypentyl]-7-hydroxy-6-methyl-5-oxo-3,6-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-7a-carboxylate.
| Compound Name | tert-butyl (6R,7S,7aS)-7-[(1S,3R)-5-dimethoxyphosphoryl-3-methyl-4-oxo-1-trimethylsilyloxypentyl]-7-hydroxy-6-methyl-5-oxo-3,6-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
|---|---|
| PubChem CID | 162397437 |
| Molecular Formula | C23H42NO10PSi |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.23 |
| IUPAC Name | tert-butyl (6R,7S,7aS)-7-[(1S,3R)-5-dimethoxyphosphoryl-3-methyl-4-oxo-1-trimethylsilyloxypentyl]-7-hydroxy-6-methyl-5-oxo-3,6-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
| SMILES | COP(=O)(CC(=O)[C@H](C)C[C@H](O[Si](C)(C)C)[C@]1(O)[C@@H](C)C(=O)N2COC[C@]21C(=O)OC(C)(C)C)OC |
| InChI | InChI=1S/C23H42NO10PSi/c1-15(17(25)12-35(29,30-6)31-7)11-18(34-36(8,9)10)23(28)16(2)19(26)24-14-32-13-22(23,24)20(27)33-21(3,4)5/h15-16,18,28H,11-14H2,1-10H3/t15-,16+,18+,22-,23-/m1/s1 |
| InChIKey | BJLSYDDICFWERV-KVEBRSCBSA-N |
| XLogP | 2.57 |
| TPSA | 137.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|