C22H38NO9PSi — CID 162397439
(1S,9R,10S)-10-[(2R)-4-dimethoxyphosphoryl-2-methyl-3-oxobutyl]-7,9-dimethyl-3,3-di(propan-2-yl)-2,4,11-trioxa-7-aza-3-silatricyclo[4.3.3.01,6]dodecane-8,12-dione (PubChem CID 162397439) has the molecular formula C22H38NO9PSi and a molecular weight of 519.60 g/mol. Its IUPAC name is (1S,9R,10S)-10-[(2R)-4-dimethoxyphosphoryl-2-methyl-3-oxobutyl]-7,9-dimethyl-3,3-di(propan-2-yl)-2,4,11-trioxa-7-aza-3-silatricyclo[4.3.3.01,6]dodecane-8,12-dione.
| Compound Name | (1S,9R,10S)-10-[(2R)-4-dimethoxyphosphoryl-2-methyl-3-oxobutyl]-7,9-dimethyl-3,3-di(propan-2-yl)-2,4,11-trioxa-7-aza-3-silatricyclo[4.3.3.01,6]dodecane-8,12-dione |
|---|---|
| PubChem CID | 162397439 |
| Molecular Formula | C22H38NO9PSi |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | (1S,9R,10S)-10-[(2R)-4-dimethoxyphosphoryl-2-methyl-3-oxobutyl]-7,9-dimethyl-3,3-di(propan-2-yl)-2,4,11-trioxa-7-aza-3-silatricyclo[4.3.3.01,6]dodecane-8,12-dione |
| SMILES | COP(=O)(CC(=O)[C@H](C)C[C@@H]1OC(=O)C23CO[Si](C(C)C)(C(C)C)O[C@]12[C@@H](C)C(=O)N3C)OC |
| InChI | InChI=1S/C22H38NO9PSi/c1-13(2)34(14(3)4)30-12-21-20(26)31-18(22(21,32-34)16(6)19(25)23(21)7)10-15(5)17(24)11-33(27,28-8)29-9/h13-16,18H,10-12H2,1-9H3/t15-,16+,18+,21?,22-/m1/s1 |
| InChIKey | MKVNBGUUYCUNFM-CJWMSRJCSA-N |
| XLogP | 2.89 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|