C19H31NO6Si — CID 24944047
(2R)-3-[(1R,6S,9R,10S)-7,9-dimethyl-8,12-dioxo-3,3-di(propan-2-yl)-2,4,11-trioxa-7-aza-3-silatricyclo[4.3.3.01,6]dodecan-10-yl]-2-methylpropanal (PubChem CID 24944047) has the molecular formula C19H31NO6Si and a molecular weight of 397.54 g/mol. Its IUPAC name is (2R)-3-[(1R,6S,9R,10S)-7,9-dimethyl-8,12-dioxo-3,3-di(propan-2-yl)-2,4,11-trioxa-7-aza-3-silatricyclo[4.3.3.01,6]dodecan-10-yl]-2-methylpropanal.
| Compound Name | (2R)-3-[(1R,6S,9R,10S)-7,9-dimethyl-8,12-dioxo-3,3-di(propan-2-yl)-2,4,11-trioxa-7-aza-3-silatricyclo[4.3.3.01,6]dodecan-10-yl]-2-methylpropanal |
|---|---|
| PubChem CID | 24944047 |
| Molecular Formula | C19H31NO6Si |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | (2R)-3-[(1R,6S,9R,10S)-7,9-dimethyl-8,12-dioxo-3,3-di(propan-2-yl)-2,4,11-trioxa-7-aza-3-silatricyclo[4.3.3.01,6]dodecan-10-yl]-2-methylpropanal |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@@]23C(=O)O[C@@H](C[C@@H](C)C=O)[C@@]2(O1)[C@@H](C)C(=O)N3C |
| InChI | InChI=1S/C19H31NO6Si/c1-11(2)27(12(3)4)24-10-18-17(23)25-15(8-13(5)9-21)19(18,26-27)14(6)16(22)20(18)7/h9,11-15H,8,10H2,1-7H3/t13-,14+,15+,18-,19+/m1/s1 |
| InChIKey | DTDUDJIGKHXSBK-LKKZHYCFSA-N |
| XLogP | 2.03 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|