C16H26NO9P — CID 162397438
(3R,3aS,4S,6aS)-4-[(2R)-4-dimethoxyphosphoryl-2-methyl-3-oxobutyl]-3a-hydroxy-6a-(hydroxymethyl)-1,3-dimethyl-3,4-dihydrofuro[3,4-b]pyrrole-2,6-dione (PubChem CID 162397438) has the molecular formula C16H26NO9P and a molecular weight of 407.36 g/mol. Its IUPAC name is (3R,3aS,4S,6aS)-4-[(2R)-4-dimethoxyphosphoryl-2-methyl-3-oxobutyl]-3a-hydroxy-6a-(hydroxymethyl)-1,3-dimethyl-3,4-dihydrofuro[3,4-b]pyrrole-2,6-dione.
| Compound Name | (3R,3aS,4S,6aS)-4-[(2R)-4-dimethoxyphosphoryl-2-methyl-3-oxobutyl]-3a-hydroxy-6a-(hydroxymethyl)-1,3-dimethyl-3,4-dihydrofuro[3,4-b]pyrrole-2,6-dione |
|---|---|
| PubChem CID | 162397438 |
| Molecular Formula | C16H26NO9P |
| Molecular Weight | 407.36 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | (3R,3aS,4S,6aS)-4-[(2R)-4-dimethoxyphosphoryl-2-methyl-3-oxobutyl]-3a-hydroxy-6a-(hydroxymethyl)-1,3-dimethyl-3,4-dihydrofuro[3,4-b]pyrrole-2,6-dione |
| SMILES | COP(=O)(CC(=O)[C@H](C)C[C@@H]1OC(=O)[C@@]2(CO)N(C)C(=O)[C@H](C)[C@@]12O)OC |
| InChI | InChI=1S/C16H26NO9P/c1-9(11(19)7-27(23,24-4)25-5)6-12-16(22)10(2)13(20)17(3)15(16,8-18)14(21)26-12/h9-10,12,18,22H,6-8H2,1-5H3/t9-,10+,12+,15-,16-/m1/s1 |
| InChIKey | DRZUAJUBEHETSX-MMZBUOGWSA-N |
| XLogP | -0.44 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.36 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|