C18H27NO9 — CID 56945931
[(3R,3aS,4S,6aS)-4-[(2R,3R)-3-acetyloxy-4-hydroxy-2-methylbutyl]-3a-hydroxy-1,3-dimethyl-2,6-dioxo-3,4-dihydrofuro[3,4-b]pyrrol-6a-yl]methyl acetate (PubChem CID 56945931) has the molecular formula C18H27NO9 and a molecular weight of 401.41 g/mol. Its IUPAC name is [(3R,3aS,4S,6aS)-4-[(2R,3R)-3-acetyloxy-4-hydroxy-2-methylbutyl]-3a-hydroxy-1,3-dimethyl-2,6-dioxo-3,4-dihydrofuro[3,4-b]pyrrol-6a-yl]methyl acetate.
| Compound Name | [(3R,3aS,4S,6aS)-4-[(2R,3R)-3-acetyloxy-4-hydroxy-2-methylbutyl]-3a-hydroxy-1,3-dimethyl-2,6-dioxo-3,4-dihydrofuro[3,4-b]pyrrol-6a-yl]methyl acetate |
|---|---|
| PubChem CID | 56945931 |
| Molecular Formula | C18H27NO9 |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | [(3R,3aS,4S,6aS)-4-[(2R,3R)-3-acetyloxy-4-hydroxy-2-methylbutyl]-3a-hydroxy-1,3-dimethyl-2,6-dioxo-3,4-dihydrofuro[3,4-b]pyrrol-6a-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]12C(=O)O[C@@H](C[C@@H](C)[C@H](CO)OC(C)=O)[C@]1(O)[C@@H](C)C(=O)N2C |
| InChI | InChI=1S/C18H27NO9/c1-9(13(7-20)27-12(4)22)6-14-18(25)10(2)15(23)19(5)17(18,16(24)28-14)8-26-11(3)21/h9-10,13-14,20,25H,6-8H2,1-5H3/t9-,10+,13+,14+,17-,18-/m1/s1 |
| InChIKey | IJRGGZWLBIMBGA-PHQBHPRYSA-N |
| XLogP | -1.00 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|