C15H23NO6 — CID 135017154
methyl (1R,2S,4R,6R,9R)-9-tert-butyl-4-(hydroxymethyl)-7-oxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylate (PubChem CID 135017154) has the molecular formula C15H23NO6 and a molecular weight of 313.35 g/mol. Its IUPAC name is methyl (1R,2S,4R,6R,9R)-9-tert-butyl-4-(hydroxymethyl)-7-oxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylate.
| Compound Name | methyl (1R,2S,4R,6R,9R)-9-tert-butyl-4-(hydroxymethyl)-7-oxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylate |
|---|---|
| PubChem CID | 135017154 |
| Molecular Formula | C15H23NO6 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | methyl (1R,2S,4R,6R,9R)-9-tert-butyl-4-(hydroxymethyl)-7-oxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylate |
| SMILES | COC(=O)[C@]12CO[C@H](C(C)(C)C)N1C(=O)[C@@H]1C[C@H](CO)O[C@@H]12 |
| InChI | InChI=1S/C15H23NO6/c1-14(2,3)12-16-11(18)9-5-8(6-17)22-10(9)15(16,7-21-12)13(19)20-4/h8-10,12,17H,5-7H2,1-4H3/t8-,9-,10+,12-,15-/m1/s1 |
| InChIKey | LOOQAAQDKXSSSZ-FXSJXDCYSA-N |
| XLogP | -0.09 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |