C15H22INO5 — CID 53238415
methyl (1R,2S,4R,6R,9R)-9-tert-butyl-4-(iodomethyl)-7-oxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylate (PubChem CID 53238415) has the molecular formula C15H22INO5 and a molecular weight of 423.25 g/mol. Its IUPAC name is methyl (1R,2S,4R,6R,9R)-9-tert-butyl-4-(iodomethyl)-7-oxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylate.
| Compound Name | methyl (1R,2S,4R,6R,9R)-9-tert-butyl-4-(iodomethyl)-7-oxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylate |
|---|---|
| PubChem CID | 53238415 |
| Molecular Formula | C15H22INO5 |
| Molecular Weight | 423.25 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | methyl (1R,2S,4R,6R,9R)-9-tert-butyl-4-(iodomethyl)-7-oxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylate |
| SMILES | COC(=O)[C@]12CO[C@H](C(C)(C)C)N1C(=O)[C@@H]1C[C@H](CI)O[C@@H]12 |
| InChI | InChI=1S/C15H22INO5/c1-14(2,3)12-17-11(18)9-5-8(6-16)22-10(9)15(17,7-21-12)13(19)20-4/h8-10,12H,5-7H2,1-4H3/t8-,9-,10+,12-,15-/m1/s1 |
| InChIKey | OJZBJMATPBWPJS-FXSJXDCYSA-N |
| XLogP | 1.35 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|