C13H19NO5 — CID 139193002
(1R,4R,7S,8R)-4-tert-butyl-8-hydroxy-7-methyl-3,10-dioxa-5-azatricyclo[6.3.0.01,5]undecane-6,11-dione (PubChem CID 139193002) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is (1R,4R,7S,8R)-4-tert-butyl-8-hydroxy-7-methyl-3,10-dioxa-5-azatricyclo[6.3.0.01,5]undecane-6,11-dione.
| Compound Name | (1R,4R,7S,8R)-4-tert-butyl-8-hydroxy-7-methyl-3,10-dioxa-5-azatricyclo[6.3.0.01,5]undecane-6,11-dione |
|---|---|
| PubChem CID | 139193002 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | (1R,4R,7S,8R)-4-tert-butyl-8-hydroxy-7-methyl-3,10-dioxa-5-azatricyclo[6.3.0.01,5]undecane-6,11-dione |
| SMILES | C[C@@H]1C(=O)N2[C@@H](C(C)(C)C)OC[C@@]23C(=O)OC[C@@]13O |
| InChI | InChI=1S/C13H19NO5/c1-7-8(15)14-9(11(2,3)4)18-5-12(14)10(16)19-6-13(7,12)17/h7,9,17H,5-6H2,1-4H3/t7-,9-,12+,13-/m1/s1 |
| InChIKey | RBHMXALBMYYFEW-HRHBAESBSA-N |
| XLogP | -0.11 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |