C13H22O4 — CID 162397794
(E,1S)-1-[(3aR,5S,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]hex-3-en-1-ol (PubChem CID 162397794) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is (E,1S)-1-[(3aR,5S,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]hex-3-en-1-ol.
| Compound Name | (E,1S)-1-[(3aR,5S,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]hex-3-en-1-ol |
|---|---|
| PubChem CID | 162397794 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (E,1S)-1-[(3aR,5S,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]hex-3-en-1-ol |
| SMILES | CC/C=C/C[C@H](O)[C@@H]1C[C@H]2OC(C)(C)O[C@H]2O1 |
| InChI | InChI=1S/C13H22O4/c1-4-5-6-7-9(14)10-8-11-12(15-10)17-13(2,3)16-11/h5-6,9-12,14H,4,7-8H2,1-3H3/b6-5+/t9-,10-,11+,12+/m0/s1 |
| InChIKey | DPEQIIXTEBLNAZ-OYJHFTGJSA-N |
| XLogP | 1.97 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|