C14H18O4 — CID 162397850
(6S)-4-[(E)-hex-4-enoyl]-3,6-dihydroxy-2,6-dimethylcyclohexa-2,4-dien-1-one (PubChem CID 162397850) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is (6S)-4-[(E)-hex-4-enoyl]-3,6-dihydroxy-2,6-dimethylcyclohexa-2,4-dien-1-one.
| Compound Name | (6S)-4-[(E)-hex-4-enoyl]-3,6-dihydroxy-2,6-dimethylcyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 162397850 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (6S)-4-[(E)-hex-4-enoyl]-3,6-dihydroxy-2,6-dimethylcyclohexa-2,4-dien-1-one |
| SMILES | C/C=C/CCC(=O)C1=C[C@](C)(O)C(=O)C(C)=C1O |
| InChI | InChI=1S/C14H18O4/c1-4-5-6-7-11(15)10-8-14(3,18)13(17)9(2)12(10)16/h4-5,8,16,18H,6-7H2,1-3H3/b5-4+/t14-/m0/s1 |
| InChIKey | KGXMXCMQWQZPBV-NNTXTVRGSA-N |
| XLogP | 2.00 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|