C16H15F2NO2 — CID 162398158
ethyl 2,2-difluoro-2-(2-methyl-5-pyridin-2-ylphenyl)acetate (PubChem CID 162398158) has the molecular formula C16H15F2NO2 and a molecular weight of 291.30 g/mol. Its IUPAC name is ethyl 2,2-difluoro-2-(2-methyl-5-pyridin-2-ylphenyl)acetate.
| Compound Name | ethyl 2,2-difluoro-2-(2-methyl-5-pyridin-2-ylphenyl)acetate |
|---|---|
| PubChem CID | 162398158 |
| Molecular Formula | C16H15F2NO2 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | ethyl 2,2-difluoro-2-(2-methyl-5-pyridin-2-ylphenyl)acetate |
| SMILES | CCOC(=O)C(F)(F)c1cc(-c2ccccn2)ccc1C |
| InChI | InChI=1S/C16H15F2NO2/c1-3-21-15(20)16(17,18)13-10-12(8-7-11(13)2)14-6-4-5-9-19-14/h4-10H,3H2,1-2H3 |
| InChIKey | DOLHKMGUCLFMBG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |