C22H19F2NO2 — CID 162398367
ethyl 2-[4-(5-benzyl-2-pyridinyl)phenyl]-2,2-difluoroacetate (PubChem CID 162398367) has the molecular formula C22H19F2NO2 and a molecular weight of 367.40 g/mol. Its IUPAC name is ethyl 2-[4-(5-benzyl-2-pyridinyl)phenyl]-2,2-difluoroacetate.
| Compound Name | ethyl 2-[4-(5-benzyl-2-pyridinyl)phenyl]-2,2-difluoroacetate |
|---|---|
| PubChem CID | 162398367 |
| Molecular Formula | C22H19F2NO2 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | ethyl 2-[4-(5-benzyl-2-pyridinyl)phenyl]-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)c1ccc(-c2ccc(Cc3ccccc3)cn2)cc1 |
| InChI | InChI=1S/C22H19F2NO2/c1-2-27-21(26)22(23,24)19-11-9-18(10-12-19)20-13-8-17(15-25-20)14-16-6-4-3-5-7-16/h3-13,15H,2,14H2,1H3 |
| InChIKey | OHVAKCQTIXWSHQ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |