C22H21BF3NO2 — CID 162398679
8-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]quinoline (PubChem CID 162398679) has the molecular formula C22H21BF3NO2 and a molecular weight of 399.22 g/mol. Its IUPAC name is 8-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]quinoline.
| Compound Name | 8-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]quinoline |
|---|---|
| PubChem CID | 162398679 |
| Molecular Formula | C22H21BF3NO2 |
| Molecular Weight | 399.22 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 8-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]quinoline |
| SMILES | CC1(C)OB(c2ccc(C(F)(F)F)cc2-c2cccc3cccnc23)OC1(C)C |
| InChI | InChI=1S/C22H21BF3NO2/c1-20(2)21(3,4)29-23(28-20)18-11-10-15(22(24,25)26)13-17(18)16-9-5-7-14-8-6-12-27-19(14)16/h5-13H,1-4H3 |
| InChIKey | GLXYVZCUALVXDB-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.22 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|