C21H20BF2NO2 — CID 162398688
8-[2,4-difluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinoline (PubChem CID 162398688) has the molecular formula C21H20BF2NO2 and a molecular weight of 367.20 g/mol. Its IUPAC name is 8-[2,4-difluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinoline.
| Compound Name | 8-[2,4-difluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinoline |
|---|---|
| PubChem CID | 162398688 |
| Molecular Formula | C21H20BF2NO2 |
| Molecular Weight | 367.20 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 8-[2,4-difluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinoline |
| SMILES | CC1(C)OB(c2cc(F)cc(F)c2-c2cccc3cccnc23)OC1(C)C |
| InChI | InChI=1S/C21H20BF2NO2/c1-20(2)21(3,4)27-22(26-20)16-11-14(23)12-17(24)18(16)15-9-5-7-13-8-6-10-25-19(13)15/h5-12H,1-4H3 |
| InChIKey | KOIFPUJNPAXIMP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.20 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|