C25H31FO5 — CID 162398723
methyl (5S)-5-[6-[(E,3R,4S)-6-(4-fluorophenyl)-3,4-dihydroxyhex-1-enyl]cyclohepta-1,3,5-trien-1-yl]-5-hydroxypentanoate (PubChem CID 162398723) has the molecular formula C25H31FO5 and a molecular weight of 430.52 g/mol. Its IUPAC name is methyl (5S)-5-[6-[(E,3R,4S)-6-(4-fluorophenyl)-3,4-dihydroxyhex-1-enyl]cyclohepta-1,3,5-trien-1-yl]-5-hydroxypentanoate.
| Compound Name | methyl (5S)-5-[6-[(E,3R,4S)-6-(4-fluorophenyl)-3,4-dihydroxyhex-1-enyl]cyclohepta-1,3,5-trien-1-yl]-5-hydroxypentanoate |
|---|---|
| PubChem CID | 162398723 |
| Molecular Formula | C25H31FO5 |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | methyl (5S)-5-[6-[(E,3R,4S)-6-(4-fluorophenyl)-3,4-dihydroxyhex-1-enyl]cyclohepta-1,3,5-trien-1-yl]-5-hydroxypentanoate |
| SMILES | COC(=O)CCC[C@H](O)C1=CC=CC=C(/C=C/[C@@H](O)[C@@H](O)CCc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C25H31FO5/c1-31-25(30)8-4-7-22(27)20-6-3-2-5-19(17-20)12-16-24(29)23(28)15-11-18-9-13-21(26)14-10-18/h2-3,5-6,9-10,12-14,16,22-24,27-29H,4,7-8,11,15,17H2,1H3/b16-12+/t22-,23-,24+/m0/s1 |
| InChIKey | ZNDHJPKNFPGPTD-GNBWCZLNSA-N |
| XLogP | 3.55 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |