C22H24O4 — CID 6438614
methyl (3R,5S,6E)-3,5-dihydroxy-9,9-diphenylnona-6,8-dienoate (PubChem CID 6438614) has the molecular formula C22H24O4 and a molecular weight of 352.43 g/mol. Its IUPAC name is methyl (3R,5S,6E)-3,5-dihydroxy-9,9-diphenylnona-6,8-dienoate.
| Compound Name | methyl (3R,5S,6E)-3,5-dihydroxy-9,9-diphenylnona-6,8-dienoate |
|---|---|
| PubChem CID | 6438614 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | methyl (3R,5S,6E)-3,5-dihydroxy-9,9-diphenylnona-6,8-dienoate |
| SMILES | COC(=O)C[C@H](O)C[C@H](O)/C=C/C=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H24O4/c1-26-22(25)16-20(24)15-19(23)13-8-14-21(17-9-4-2-5-10-17)18-11-6-3-7-12-18/h2-14,19-20,23-24H,15-16H2,1H3/b13-8+/t19-,20-/m1/s1 |
| InChIKey | NSZBOSJMBQKKKB-ZCBOBATRSA-N |
| XLogP | 3.35 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|