C12H24O2 — CID 162399740
trans-(2S,3S)-2,3-ditert-butyl-1-methoxycyclopropan-1-ol (PubChem CID 162399740) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is trans-(2S,3S)-2,3-ditert-butyl-1-methoxycyclopropan-1-ol.
| Compound Name | trans-(2S,3S)-2,3-ditert-butyl-1-methoxycyclopropan-1-ol |
|---|---|
| PubChem CID | 162399740 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | trans-(2S,3S)-2,3-ditert-butyl-1-methoxycyclopropan-1-ol |
| SMILES | COC1(O)[C@H](C(C)(C)C)[C@H]1C(C)(C)C |
| InChI | InChI=1S/C12H24O2/c1-10(2,3)8-9(11(4,5)6)12(8,13)14-7/h8-9,13H,1-7H3/t8-,9-/m0/s1 |
| InChIKey | APKYDVUIOJGTQC-IUCAKERBSA-N |
| XLogP | 2.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|